C17H13F4NO3 — CID 132941467
(3R)-3-fluoro-3-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-1-methylindol-2-one (PubChem CID 132941467) has the molecular formula C17H13F4NO3 and a molecular weight of 355.29 g/mol. Its IUPAC name is (3R)-3-fluoro-3-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-1-methylindol-2-one.
| Compound Name | (3R)-3-fluoro-3-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-1-methylindol-2-one |
|---|---|
| PubChem CID | 132941467 |
| Molecular Formula | C17H13F4NO3 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (3R)-3-fluoro-3-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-1-methylindol-2-one |
| SMILES | CN1C(=O)[C@](F)(C(O)c2ccc(OC(F)(F)F)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H13F4NO3/c1-22-13-5-3-2-4-12(13)16(18,15(22)24)14(23)10-6-8-11(9-7-10)25-17(19,20)21/h2-9,14,23H,1H3/t14?,16-/m1/s1 |
| InChIKey | YVBJSEBJQBKSJP-BZSJEYESSA-N |
| XLogP | 3.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |