C23H19F3N2O3 — CID 177445570
(3R)-1-methyl-3-(3-oxo-3-phenylpropyl)-3-pyrrol-1-yl-5-(trifluoromethoxy)indol-2-one (PubChem CID 177445570) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is (3R)-1-methyl-3-(3-oxo-3-phenylpropyl)-3-pyrrol-1-yl-5-(trifluoromethoxy)indol-2-one.
| Compound Name | (3R)-1-methyl-3-(3-oxo-3-phenylpropyl)-3-pyrrol-1-yl-5-(trifluoromethoxy)indol-2-one |
|---|---|
| PubChem CID | 177445570 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (3R)-1-methyl-3-(3-oxo-3-phenylpropyl)-3-pyrrol-1-yl-5-(trifluoromethoxy)indol-2-one |
| SMILES | CN1C(=O)[C@](CCC(=O)c2ccccc2)(n2cccc2)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H19F3N2O3/c1-27-19-10-9-17(31-23(24,25)26)15-18(19)22(21(27)30,28-13-5-6-14-28)12-11-20(29)16-7-3-2-4-8-16/h2-10,13-15H,11-12H2,1H3/t22-/m1/s1 |
| InChIKey | BGMFWSLLYJKXQO-JOCHJYFZSA-N |
| XLogP | 4.77 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |