C25H17F3N2O6 — CID 15949110
2-[1'-(Naphthalen-1-ylmethyl)-2,2',5'-trioxo-5-(trifluoromethoxy)spiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid (PubChem CID 15949110) has the molecular formula C25H17F3N2O6 and a molecular weight of 498.40 g/mol. Its IUPAC name is 2-[1'-(naphthalen-1-ylmethyl)-2,2',5'-trioxo-5-(trifluoromethoxy)spiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid.
| Compound Name | 2-[1'-(Naphthalen-1-ylmethyl)-2,2',5'-trioxo-5-(trifluoromethoxy)spiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
|---|---|
| PubChem CID | 15949110 |
| Molecular Formula | C25H17F3N2O6 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-[1'-(naphthalen-1-ylmethyl)-2,2',5'-trioxo-5-(trifluoromethoxy)spiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
| SMILES | C1C(=O)N(C(=O)C12C3=C(C=CC(=C3)OC(F)(F)F)N(C2=O)CC(=O)O)CC4=CC=CC5=CC=CC=C54 |
| InChI | InChI=1S/C25H17F3N2O6/c26-25(27,28)36-16-8-9-19-18(10-16)24(22(34)29(19)13-21(32)33)11-20(31)30(23(24)35)12-15-6-3-5-14-4-1-2-7-17(14)15/h1-10H,11-13H2,(H,32,33) |
| InChIKey | VPIOMNUUAVOVBL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | 941 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|