C16H12N2O5 — CID 10828885
2-[3-(naphthalen-1-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]acetic acid (PubChem CID 10828885) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 2-[3-(naphthalen-1-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[3-(naphthalen-1-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10828885 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[3-(naphthalen-1-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)N(Cc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C16H12N2O5/c19-13(20)9-18-15(22)14(21)17(16(18)23)8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2,(H,19,20) |
| InChIKey | FQWQINJVGHEFNA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|