C16H11NO3 — CID 177386662
1'-methylspiro[2-benzofuran-3,3'-indole]-1,2'-dione (PubChem CID 177386662) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1'-methylspiro[2-benzofuran-3,3'-indole]-1,2'-dione.
| Compound Name | 1'-methylspiro[2-benzofuran-3,3'-indole]-1,2'-dione |
|---|---|
| PubChem CID | 177386662 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1'-methylspiro[2-benzofuran-3,3'-indole]-1,2'-dione |
| SMILES | CN1C(=O)C2(OC(=O)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C16H11NO3/c1-17-13-9-5-4-8-12(13)16(15(17)19)11-7-3-2-6-10(11)14(18)20-16/h2-9H,1H3 |
| InChIKey | VTVUIBZHFUFUFU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |