C20H27NO2 — CID 138982712
4-(cyclohexylmethyl)-4-methyl-2-propylisoquinoline-1,3-dione (PubChem CID 138982712) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-4-methyl-2-propylisoquinoline-1,3-dione.
| Compound Name | 4-(cyclohexylmethyl)-4-methyl-2-propylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 138982712 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-(cyclohexylmethyl)-4-methyl-2-propylisoquinoline-1,3-dione |
| SMILES | CCCN1C(=O)c2ccccc2C(C)(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C20H27NO2/c1-3-13-21-18(22)16-11-7-8-12-17(16)20(2,19(21)23)14-15-9-5-4-6-10-15/h7-8,11-12,15H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | NYJNMLSBZIWBQY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|