C26H29N3O2 — CID 71559820
N-cyclohexyl-1-(1H-indol-2-yl)-3-oxo-2-propylisoindole-1-carboxamide (PubChem CID 71559820) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-cyclohexyl-1-(1H-indol-2-yl)-3-oxo-2-propylisoindole-1-carboxamide.
| Compound Name | N-cyclohexyl-1-(1H-indol-2-yl)-3-oxo-2-propylisoindole-1-carboxamide |
|---|---|
| PubChem CID | 71559820 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-cyclohexyl-1-(1H-indol-2-yl)-3-oxo-2-propylisoindole-1-carboxamide |
| SMILES | CCCN1C(=O)c2ccccc2C1(C(=O)NC1CCCCC1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H29N3O2/c1-2-16-29-24(30)20-13-7-8-14-21(20)26(29,25(31)27-19-11-4-3-5-12-19)23-17-18-10-6-9-15-22(18)28-23/h6-10,13-15,17,19,28H,2-5,11-12,16H2,1H3,(H,27,31) |
| InChIKey | IIBMFXTYWRUIQW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |