C27H41N3O2 — CID 92668065
(3S)-2-[2-(azepan-1-yl)ethyl]-N-cyclooctyl-3-methyl-1-oxo-4H-isoquinoline-3-carboxamide (PubChem CID 92668065) has the molecular formula C27H41N3O2 and a molecular weight of 439.64 g/mol. Its IUPAC name is (3S)-2-[2-(azepan-1-yl)ethyl]-N-cyclooctyl-3-methyl-1-oxo-4H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[2-(azepan-1-yl)ethyl]-N-cyclooctyl-3-methyl-1-oxo-4H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 92668065 |
| Molecular Formula | C27H41N3O2 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | (3S)-2-[2-(azepan-1-yl)ethyl]-N-cyclooctyl-3-methyl-1-oxo-4H-isoquinoline-3-carboxamide |
| SMILES | C[C@@]1(C(=O)NC2CCCCCCC2)Cc2ccccc2C(=O)N1CCN1CCCCCC1 |
| InChI | InChI=1S/C27H41N3O2/c1-27(26(32)28-23-14-7-3-2-4-8-15-23)21-22-13-9-10-16-24(22)25(31)30(27)20-19-29-17-11-5-6-12-18-29/h9-10,13,16,23H,2-8,11-12,14-15,17-21H2,1H3,(H,28,32)/t27-/m0/s1 |
| InChIKey | LMWLCJVWDFABDJ-MHZLTWQESA-N |
| XLogP | 4.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |