C25H36N2O2 — CID 20885760
2-cyclohexyl-N-cyclooctyl-3-methyl-1-oxo-4H-isoquinoline-3-carboxamide (PubChem CID 20885760) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-cyclohexyl-N-cyclooctyl-3-methyl-1-oxo-4H-isoquinoline-3-carboxamide.
| Compound Name | 2-cyclohexyl-N-cyclooctyl-3-methyl-1-oxo-4H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 20885760 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 2-cyclohexyl-N-cyclooctyl-3-methyl-1-oxo-4H-isoquinoline-3-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCCCC2)Cc2ccccc2C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C25H36N2O2/c1-25(24(29)26-20-13-6-3-2-4-7-14-20)18-19-12-10-11-17-22(19)23(28)27(25)21-15-8-5-9-16-21/h10-12,17,20-21H,2-9,13-16,18H2,1H3,(H,26,29) |
| InChIKey | GLZLHHIYDLGOIQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |