C27H34N2O2 — CID 20885762
N-cyclooctyl-3-methyl-1-oxo-2-(2-phenylethyl)-4H-isoquinoline-3-carboxamide (PubChem CID 20885762) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-cyclooctyl-3-methyl-1-oxo-2-(2-phenylethyl)-4H-isoquinoline-3-carboxamide.
| Compound Name | N-cyclooctyl-3-methyl-1-oxo-2-(2-phenylethyl)-4H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 20885762 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-cyclooctyl-3-methyl-1-oxo-2-(2-phenylethyl)-4H-isoquinoline-3-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCCCC2)Cc2ccccc2C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C27H34N2O2/c1-27(26(31)28-23-15-8-3-2-4-9-16-23)20-22-14-10-11-17-24(22)25(30)29(27)19-18-21-12-6-5-7-13-21/h5-7,10-14,17,23H,2-4,8-9,15-16,18-20H2,1H3,(H,28,31) |
| InChIKey | JPAWGSFERJPLHH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |