C24H27NO2 — CID 138982714
2-benzyl-4-(cyclohexylmethyl)-4-methylisoquinoline-1,3-dione (PubChem CID 138982714) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-benzyl-4-(cyclohexylmethyl)-4-methylisoquinoline-1,3-dione.
| Compound Name | 2-benzyl-4-(cyclohexylmethyl)-4-methylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 138982714 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-benzyl-4-(cyclohexylmethyl)-4-methylisoquinoline-1,3-dione |
| SMILES | CC1(CC2CCCCC2)C(=O)N(Cc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H27NO2/c1-24(16-18-10-4-2-5-11-18)21-15-9-8-14-20(21)22(26)25(23(24)27)17-19-12-6-3-7-13-19/h3,6-9,12-15,18H,2,4-5,10-11,16-17H2,1H3 |
| InChIKey | UJXZHBDWBLRVQI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|