C42H44N4O6 — CID 145242643
2-[(4E,6E,8E)-8-[3,3-dimethyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]-2-methyl-3-methylideneocta-4,6-dien-2-yl]-4-nitro-N-(2-phenoxyethyl)aniline (PubChem CID 145242643) has the molecular formula C42H44N4O6 and a molecular weight of 700.84 g/mol. Its IUPAC name is 2-[(4E,6E,8E)-8-[3,3-dimethyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]-2-methyl-3-methylideneocta-4,6-dien-2-yl]-4-nitro-N-(2-phenoxyethyl)aniline.
| Compound Name | 2-[(4E,6E,8E)-8-[3,3-dimethyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]-2-methyl-3-methylideneocta-4,6-dien-2-yl]-4-nitro-N-(2-phenoxyethyl)aniline |
|---|---|
| PubChem CID | 145242643 |
| Molecular Formula | C42H44N4O6 |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.33 |
| IUPAC Name | 2-[(4E,6E,8E)-8-[3,3-dimethyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]-2-methyl-3-methylideneocta-4,6-dien-2-yl]-4-nitro-N-(2-phenoxyethyl)aniline |
| SMILES | C=C(/C=C/C=C/C=C1/N(CCOc2ccccc2)c2ccc([N+](=O)[O-])cc2C1(C)C)C(C)(C)c1cc([N+](=O)[O-])ccc1NCCOc1ccccc1 |
| InChI | InChI=1S/C42H44N4O6/c1-31(41(2,3)36-29-32(45(47)48)21-23-38(36)43-25-27-51-34-16-10-7-11-17-34)15-9-6-14-20-40-42(4,5)37-30-33(46(49)50)22-24-39(37)44(40)26-28-52-35-18-12-8-13-19-35/h6-24,29-30,43H,1,25-28H2,2-5H3/b14-6+,15-9+,40-20+ |
| InChIKey | ZYONBMOYMFWTSC-VQRUBEGRSA-N |
| XLogP | 9.70 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|