C37H38N4O8 — CID 142079452
2-[(2E)-2-[(2E,4E)-7-[5-(carboxymethyl)-2-[(3,5-dinitrophenyl)methylamino]phenyl]-7-methyl-6-methylideneocta-2,4-dienylidene]-3,3-dimethyl-1H-indol-5-yl]acetic acid (PubChem CID 142079452) has the molecular formula C37H38N4O8 and a molecular weight of 666.73 g/mol. Its IUPAC name is 2-[(2E)-2-[(2E,4E)-7-[5-(carboxymethyl)-2-[(3,5-dinitrophenyl)methylamino]phenyl]-7-methyl-6-methylideneocta-2,4-dienylidene]-3,3-dimethyl-1H-indol-5-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[(2E,4E)-7-[5-(carboxymethyl)-2-[(3,5-dinitrophenyl)methylamino]phenyl]-7-methyl-6-methylideneocta-2,4-dienylidene]-3,3-dimethyl-1H-indol-5-yl]acetic acid |
|---|---|
| PubChem CID | 142079452 |
| Molecular Formula | C37H38N4O8 |
| Molecular Weight | 666.73 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | 2-[(2E)-2-[(2E,4E)-7-[5-(carboxymethyl)-2-[(3,5-dinitrophenyl)methylamino]phenyl]-7-methyl-6-methylideneocta-2,4-dienylidene]-3,3-dimethyl-1H-indol-5-yl]acetic acid |
| SMILES | C=C(/C=C/C=C/C=C1/Nc2ccc(CC(=O)O)cc2C1(C)C)C(C)(C)c1cc(CC(=O)O)ccc1NCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H38N4O8/c1-23(9-7-6-8-10-33-37(4,5)30-18-25(20-35(44)45)12-14-32(30)39-33)36(2,3)29-17-24(19-34(42)43)11-13-31(29)38-22-26-15-27(40(46)47)21-28(16-26)41(48)49/h6-18,21,38-39H,1,19-20,22H2,2-5H3,(H,42,43)(H,44,45)/b8-6+,9-7+,33-10+ |
| InChIKey | XWPQUCVUCYEUHU-JHBSRCQZSA-N |
| XLogP | 7.60 |
| TPSA | 184.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.73 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|