C28H33N3O8 — CID 142079446
acetyloxymethyl 2-[4-[(3,5-dinitrophenyl)methylamino]-3-[(4E,6E)-2-methylnona-4,6-dien-2-yl]phenyl]acetate (PubChem CID 142079446) has the molecular formula C28H33N3O8 and a molecular weight of 539.59 g/mol. Its IUPAC name is acetyloxymethyl 2-[4-[(3,5-dinitrophenyl)methylamino]-3-[(4E,6E)-2-methylnona-4,6-dien-2-yl]phenyl]acetate.
| Compound Name | acetyloxymethyl 2-[4-[(3,5-dinitrophenyl)methylamino]-3-[(4E,6E)-2-methylnona-4,6-dien-2-yl]phenyl]acetate |
|---|---|
| PubChem CID | 142079446 |
| Molecular Formula | C28H33N3O8 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | acetyloxymethyl 2-[4-[(3,5-dinitrophenyl)methylamino]-3-[(4E,6E)-2-methylnona-4,6-dien-2-yl]phenyl]acetate |
| SMILES | CC/C=C/C=C/CC(C)(C)c1cc(CC(=O)OCOC(C)=O)ccc1NCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H33N3O8/c1-5-6-7-8-9-12-28(3,4)25-15-21(16-27(33)39-19-38-20(2)32)10-11-26(25)29-18-22-13-23(30(34)35)17-24(14-22)31(36)37/h6-11,13-15,17,29H,5,12,16,18-19H2,1-4H3/b7-6+,9-8+ |
| InChIKey | PHYBCCXYUCPNRO-BLHCBFLLSA-N |
| XLogP | 5.91 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|