C39H47N4O8+ — CID 142079442
(3,5-dinitrophenyl)methyl-[4-(2-ethoxy-2-oxoethyl)-2-[(E,6E)-6-[5-(2-ethoxy-2-oxoethyl)-1,3,3-trimethylindol-2-ylidene]-2-methylhex-4-en-2-yl]phenyl]azanium (PubChem CID 142079442) has the molecular formula C39H47N4O8+ and a molecular weight of 699.82 g/mol. Its IUPAC name is (3,5-dinitrophenyl)methyl-[4-(2-ethoxy-2-oxoethyl)-2-[(E,6E)-6-[5-(2-ethoxy-2-oxoethyl)-1,3,3-trimethylindol-2-ylidene]-2-methylhex-4-en-2-yl]phenyl]azanium.
| Compound Name | (3,5-dinitrophenyl)methyl-[4-(2-ethoxy-2-oxoethyl)-2-[(E,6E)-6-[5-(2-ethoxy-2-oxoethyl)-1,3,3-trimethylindol-2-ylidene]-2-methylhex-4-en-2-yl]phenyl]azanium |
|---|---|
| PubChem CID | 142079442 |
| Molecular Formula | C39H47N4O8+ |
| Molecular Weight | 699.82 g/mol |
| Exact Mass | 699.34 |
| IUPAC Name | (3,5-dinitrophenyl)methyl-[4-(2-ethoxy-2-oxoethyl)-2-[(E,6E)-6-[5-(2-ethoxy-2-oxoethyl)-1,3,3-trimethylindol-2-ylidene]-2-methylhex-4-en-2-yl]phenyl]azanium |
| SMILES | CCOC(=O)Cc1ccc([NH2+]Cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c(C(C)(C)C/C=C/C=C2/N(C)c3ccc(CC(=O)OCC)cc3C2(C)C)c1 |
| InChI | InChI=1S/C39H46N4O8/c1-8-50-36(44)22-26-13-15-33(40-25-28-18-29(42(46)47)24-30(19-28)43(48)49)31(20-26)38(3,4)17-11-10-12-35-39(5,6)32-21-27(23-37(45)51-9-2)14-16-34(32)41(35)7/h10-16,18-21,24,40H,8-9,17,22-23,25H2,1-7H3/p+1/b11-10+,35-12+ |
| InChIKey | LHERIBBKOBTTHB-XHGZHKEGSA-O |
| XLogP | 6.64 |
| TPSA | 158.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|