C29H36N2 — CID 123300574
N-methyl-2-[2-methyl-10-(1,3,3-trimethylindol-2-ylidene)deca-4,6,8-trien-2-yl]aniline (PubChem CID 123300574) has the molecular formula C29H36N2 and a molecular weight of 412.62 g/mol. Its IUPAC name is N-methyl-2-[2-methyl-10-(1,3,3-trimethylindol-2-ylidene)deca-4,6,8-trien-2-yl]aniline.
| Compound Name | N-methyl-2-[2-methyl-10-(1,3,3-trimethylindol-2-ylidene)deca-4,6,8-trien-2-yl]aniline |
|---|---|
| PubChem CID | 123300574 |
| Molecular Formula | C29H36N2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | N-methyl-2-[2-methyl-10-(1,3,3-trimethylindol-2-ylidene)deca-4,6,8-trien-2-yl]aniline |
| SMILES | CNc1ccccc1C(C)(C)CC=CC=CC=CC=C1N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C29H36N2/c1-28(2,23-17-12-14-19-25(23)30-5)22-16-10-8-7-9-11-21-27-29(3,4)24-18-13-15-20-26(24)31(27)6/h7-21,30H,22H2,1-6H3 |
| InChIKey | VHXYUMYDHUXPOY-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|