C44H46N2 — CID 145312935
N-[(1E,3E,5E,7E)-7-[3-[(4-ethenylphenyl)methyl]-1,3-dimethylindol-2-ylidene]hepta-1,3,5-trienyl]-2-[1-(4-ethenylphenyl)-2-methylpropan-2-yl]aniline (PubChem CID 145312935) has the molecular formula C44H46N2 and a molecular weight of 602.87 g/mol. Its IUPAC name is N-[(1E,3E,5E,7E)-7-[3-[(4-ethenylphenyl)methyl]-1,3-dimethylindol-2-ylidene]hepta-1,3,5-trienyl]-2-[1-(4-ethenylphenyl)-2-methylpropan-2-yl]aniline.
| Compound Name | N-[(1E,3E,5E,7E)-7-[3-[(4-ethenylphenyl)methyl]-1,3-dimethylindol-2-ylidene]hepta-1,3,5-trienyl]-2-[1-(4-ethenylphenyl)-2-methylpropan-2-yl]aniline |
|---|---|
| PubChem CID | 145312935 |
| Molecular Formula | C44H46N2 |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 602.37 |
| IUPAC Name | N-[(1E,3E,5E,7E)-7-[3-[(4-ethenylphenyl)methyl]-1,3-dimethylindol-2-ylidene]hepta-1,3,5-trienyl]-2-[1-(4-ethenylphenyl)-2-methylpropan-2-yl]aniline |
| SMILES | C=Cc1ccc(CC(C)(C)c2ccccc2N/C=C/C=C/C=C/C=C2/N(C)c3ccccc3C2(C)Cc2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C44H46N2/c1-7-34-23-27-36(28-24-34)32-43(3,4)38-18-13-15-20-40(38)45-31-17-11-9-10-12-22-42-44(5,33-37-29-25-35(8-2)26-30-37)39-19-14-16-21-41(39)46(42)6/h7-31,45H,1-2,32-33H2,3-6H3/b11-9+,12-10+,31-17+,42-22+ |
| InChIKey | RIZOKYCEMBGWBQ-DIEZNQDUSA-N |
| XLogP | 11.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|