C28H30N3+ — CID 59319648
2-[(3-benzyl-1,3-dimethylindol-2-ylidene)methyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium (PubChem CID 59319648) has the molecular formula C28H30N3+ and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-[(3-benzyl-1,3-dimethylindol-2-ylidene)methyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium.
| Compound Name | 2-[(3-benzyl-1,3-dimethylindol-2-ylidene)methyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium |
|---|---|
| PubChem CID | 59319648 |
| Molecular Formula | C28H30N3+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-[(3-benzyl-1,3-dimethylindol-2-ylidene)methyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium |
| SMILES | CN1C(=CC2=[N+](C)c3ncccc3C2(C)C)C(C)(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H30N3/c1-27(2)22-15-11-17-29-26(22)31(5)24(27)18-25-28(3,19-20-12-7-6-8-13-20)21-14-9-10-16-23(21)30(25)4/h6-18H,19H2,1-5H3/q+1 |
| InChIKey | HENGEEUKHAPYSX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 19.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|