C37H42N4O6 — CID 145055551
2-[(4E,6E,8E,10E)-10-[1-[(3,5-dinitrophenyl)methyl]-5-methoxy-3,3-dimethylindol-2-ylidene]-2-methyldeca-4,6,8-trien-2-yl]-4-methoxy-N-methylaniline (PubChem CID 145055551) has the molecular formula C37H42N4O6 and a molecular weight of 638.77 g/mol. Its IUPAC name is 2-[(4E,6E,8E,10E)-10-[1-[(3,5-dinitrophenyl)methyl]-5-methoxy-3,3-dimethylindol-2-ylidene]-2-methyldeca-4,6,8-trien-2-yl]-4-methoxy-N-methylaniline.
| Compound Name | 2-[(4E,6E,8E,10E)-10-[1-[(3,5-dinitrophenyl)methyl]-5-methoxy-3,3-dimethylindol-2-ylidene]-2-methyldeca-4,6,8-trien-2-yl]-4-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 145055551 |
| Molecular Formula | C37H42N4O6 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 2-[(4E,6E,8E,10E)-10-[1-[(3,5-dinitrophenyl)methyl]-5-methoxy-3,3-dimethylindol-2-ylidene]-2-methyldeca-4,6,8-trien-2-yl]-4-methoxy-N-methylaniline |
| SMILES | CNc1ccc(OC)cc1C(C)(C)C/C=C/C=C/C=C/C=C1/N(Cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c2ccc(OC)cc2C1(C)C |
| InChI | InChI=1S/C37H42N4O6/c1-36(2,31-23-29(46-6)15-17-33(31)38-5)19-13-11-9-8-10-12-14-35-37(3,4)32-24-30(47-7)16-18-34(32)39(35)25-26-20-27(40(42)43)22-28(21-26)41(44)45/h8-18,20-24,38H,19,25H2,1-7H3/b9-8+,12-10+,13-11+,35-14+ |
| InChIKey | ZAMSCEOEHYAVQN-OZWPAHTLSA-N |
| XLogP | 8.78 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|