C40H36N2O3S — CID 88963476
2-[7-[9,9-dimethyl-7-(2-sulfanylethylamino)fluoren-2-yl]-9,9-dimethylfluoren-2-yl]-1-(4-nitrophenyl)ethanone (PubChem CID 88963476) has the molecular formula C40H36N2O3S and a molecular weight of 624.81 g/mol. Its IUPAC name is 2-[7-[9,9-dimethyl-7-(2-sulfanylethylamino)fluoren-2-yl]-9,9-dimethylfluoren-2-yl]-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[7-[9,9-dimethyl-7-(2-sulfanylethylamino)fluoren-2-yl]-9,9-dimethylfluoren-2-yl]-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 88963476 |
| Molecular Formula | C40H36N2O3S |
| Molecular Weight | 624.81 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 2-[7-[9,9-dimethyl-7-(2-sulfanylethylamino)fluoren-2-yl]-9,9-dimethylfluoren-2-yl]-1-(4-nitrophenyl)ethanone |
| SMILES | CC1(C)c2cc(CC(=O)c3ccc([N+](=O)[O-])cc3)ccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(NCCS)ccc3-4)cc21 |
| InChI | InChI=1S/C40H36N2O3S/c1-39(2)34-19-24(20-38(43)25-6-11-29(12-7-25)42(44)45)5-13-30(34)31-14-8-26(21-35(31)39)27-9-15-32-33-16-10-28(41-17-18-46)23-37(33)40(3,4)36(32)22-27/h5-16,19,21-23,41,46H,17-18,20H2,1-4H3 |
| InChIKey | XERCQOMNTBZSHO-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.81 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|