C34H34N4O5S — CID 145162737
5-[(2E)-2-[3-benzyl-3-methyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]ethylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 145162737) has the molecular formula C34H34N4O5S and a molecular weight of 610.74 g/mol. Its IUPAC name is 5-[(2E)-2-[3-benzyl-3-methyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]ethylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(2E)-2-[3-benzyl-3-methyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]ethylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 145162737 |
| Molecular Formula | C34H34N4O5S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 5-[(2E)-2-[3-benzyl-3-methyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]ethylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=C/C=C2/N(CCOc3ccccc3)c3ccc([N+](=O)[O-])cc3C2(C)Cc2ccccc2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C34H34N4O5S/c1-4-35-31(39)27(32(40)36(5-2)33(35)44)17-19-30-34(3,23-24-12-8-6-9-13-24)28-22-25(38(41)42)16-18-29(28)37(30)20-21-43-26-14-10-7-11-15-26/h6-19,22H,4-5,20-21,23H2,1-3H3/b30-19+ |
| InChIKey | UYCGDHGPNTZCPZ-NDZAJKAJSA-N |
| XLogP | 5.80 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|