C37H42N4O4 — CID 145162710
(2E)-2-[2-(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)ethylidene]-3,3-dimethyl-1-(2-phenoxyethyl)indole-5-carbonitrile (PubChem CID 145162710) has the molecular formula C37H42N4O4 and a molecular weight of 606.77 g/mol. Its IUPAC name is (2E)-2-[2-(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)ethylidene]-3,3-dimethyl-1-(2-phenoxyethyl)indole-5-carbonitrile.
| Compound Name | (2E)-2-[2-(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)ethylidene]-3,3-dimethyl-1-(2-phenoxyethyl)indole-5-carbonitrile |
|---|---|
| PubChem CID | 145162710 |
| Molecular Formula | C37H42N4O4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | (2E)-2-[2-(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)ethylidene]-3,3-dimethyl-1-(2-phenoxyethyl)indole-5-carbonitrile |
| SMILES | CC1(C)/C(=C\C=C2C(=O)N(C3CCCCC3)C(=O)N(C3CCCCC3)C2=O)N(CCOc2ccccc2)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C37H42N4O4/c1-37(2)31-24-26(25-38)18-20-32(31)39(22-23-45-29-16-10-5-11-17-29)33(37)21-19-30-34(42)40(27-12-6-3-7-13-27)36(44)41(35(30)43)28-14-8-4-9-15-28/h5,10-11,16-21,24,27-28H,3-4,6-9,12-15,22-23H2,1-2H3/b33-21+ |
| InChIKey | GJVDLKJMKYUNBY-QNKGDIEWSA-N |
| XLogP | 7.00 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|