C39H52F3N3O6 — CID 145162798
5-[(2E)-2-[3,3-dimethyl-1-(2-phenoxyethyl)-5-(trifluoromethyl)indol-2-ylidene]ethylidene]-1,3-bis(6-hydroxyhexyl)-1,3-diazinane-2,4,6-trione;ethane (PubChem CID 145162798) has the molecular formula C39H52F3N3O6 and a molecular weight of 715.85 g/mol. Its IUPAC name is 5-[(2E)-2-[3,3-dimethyl-1-(2-phenoxyethyl)-5-(trifluoromethyl)indol-2-ylidene]ethylidene]-1,3-bis(6-hydroxyhexyl)-1,3-diazinane-2,4,6-trione;ethane.
| Compound Name | 5-[(2E)-2-[3,3-dimethyl-1-(2-phenoxyethyl)-5-(trifluoromethyl)indol-2-ylidene]ethylidene]-1,3-bis(6-hydroxyhexyl)-1,3-diazinane-2,4,6-trione;ethane |
|---|---|
| PubChem CID | 145162798 |
| Molecular Formula | C39H52F3N3O6 |
| Molecular Weight | 715.85 g/mol |
| Exact Mass | 715.38 |
| IUPAC Name | 5-[(2E)-2-[3,3-dimethyl-1-(2-phenoxyethyl)-5-(trifluoromethyl)indol-2-ylidene]ethylidene]-1,3-bis(6-hydroxyhexyl)-1,3-diazinane-2,4,6-trione;ethane |
| SMILES | CC.CC1(C)/C(=C\C=C2C(=O)N(CCCCCCO)C(=O)N(CCCCCCO)C2=O)N(CCOc2ccccc2)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C37H46F3N3O6.C2H6/c1-36(2)30-26-27(37(38,39)40)16-18-31(30)41(22-25-49-28-14-8-7-9-15-28)32(36)19-17-29-33(46)42(20-10-3-5-12-23-44)35(48)43(34(29)47)21-11-4-6-13-24-45;1-2/h7-9,14-19,26,44-45H,3-6,10-13,20-25H2,1-2H3;1-2H3/b32-19+; |
| InChIKey | ILHDUBFFLOTYER-SOBPZFRWSA-N |
| XLogP | 7.61 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.85 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|