C25H20N2O6S — CID 126061701
(5Z)-5-[[4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-phenoxyethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126061701) has the molecular formula C25H20N2O6S and a molecular weight of 476.51 g/mol. Its IUPAC name is (5Z)-5-[[4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-phenoxyethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-phenoxyethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126061701 |
| Molecular Formula | C25H20N2O6S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | (5Z)-5-[[4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-phenoxyethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc(OCc3cccc([N+](=O)[O-])c3)cc2)C(=O)N1CCOc1ccccc1 |
| InChI | InChI=1S/C25H20N2O6S/c28-24-23(34-25(29)26(24)13-14-32-21-7-2-1-3-8-21)16-18-9-11-22(12-10-18)33-17-19-5-4-6-20(15-19)27(30)31/h1-12,15-16H,13-14,17H2/b23-16- |
| InChIKey | YJORSCCDPCBRGP-KQWNVCNZSA-N |
| XLogP | 5.29 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|