C32H36Cl2N6O3S — CID 58582844
4-[2-[3-[5-[[(4,6-dichloro-1,3,5-triazin-2-yl)amino]methyl]-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butyl sulfite (PubChem CID 58582844) has the molecular formula C32H36Cl2N6O3S and a molecular weight of 655.65 g/mol. Its IUPAC name is 4-[2-[3-[5-[[(4,6-dichloro-1,3,5-triazin-2-yl)amino]methyl]-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butyl sulfite.
| Compound Name | 4-[2-[3-[5-[[(4,6-dichloro-1,3,5-triazin-2-yl)amino]methyl]-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butyl sulfite |
|---|---|
| PubChem CID | 58582844 |
| Molecular Formula | C32H36Cl2N6O3S |
| Molecular Weight | 655.65 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | 4-[2-[3-[5-[[(4,6-dichloro-1,3,5-triazin-2-yl)amino]methyl]-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butyl sulfite |
| SMILES | C[N+]1=C(C=CC=C2N(CCCCOS(=O)[O-])c3ccccc3C2(C)C)C(C)(C)c2cc(CNc3nc(Cl)nc(Cl)n3)ccc21 |
| InChI | InChI=1S/C32H36Cl2N6O3S/c1-31(2)22-11-6-7-12-25(22)40(17-8-9-18-43-44(41)42)27(31)14-10-13-26-32(3,4)23-19-21(15-16-24(23)39(26)5)20-35-30-37-28(33)36-29(34)38-30/h6-7,10-16,19H,8-9,17-18,20H2,1-5H3,(H-,35,36,37,38,41,42) |
| InChIKey | BDWUZXIVXJTLAR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|