C35H41IN2O7 — CID 160945727
4-[2-[5-[1-(4-hydroxypent-4-enyl)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]butanoic acid;oxidooxy carboniodidate (PubChem CID 160945727) has the molecular formula C35H41IN2O7 and a molecular weight of 728.62 g/mol. Its IUPAC name is 4-[2-[5-[1-(4-hydroxypent-4-enyl)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]butanoic acid;oxidooxy carboniodidate.
| Compound Name | 4-[2-[5-[1-(4-hydroxypent-4-enyl)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]butanoic acid;oxidooxy carboniodidate |
|---|---|
| PubChem CID | 160945727 |
| Molecular Formula | C35H41IN2O7 |
| Molecular Weight | 728.62 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | 4-[2-[5-[1-(4-hydroxypent-4-enyl)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]butanoic acid;oxidooxy carboniodidate |
| SMILES | C=C(O)CCC[N+]1=C(C=CC=CC=C2N(CCCC(=O)O)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.O=C(I)OO[O-] |
| InChI | InChI=1S/C34H40N2O3.CHIO4/c1-25(37)15-13-23-35-28-18-11-9-16-26(28)33(2,3)30(35)20-7-6-8-21-31-34(4,5)27-17-10-12-19-29(27)36(31)24-14-22-32(38)39;2-1(3)5-6-4/h6-12,16-21H,1,13-15,22-24H2,2-5H3,(H-,37,38,39);4H |
| InChIKey | WHYJJKICMCNKGD-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.62 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|