C38H56N3O6+ — CID 130209812
2-[2-[2-[2-[(E,3E)-3-[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3,3-dimethylindol-2-ylidene]prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanamine (PubChem CID 130209812) has the molecular formula C38H56N3O6+ and a molecular weight of 650.88 g/mol. Its IUPAC name is 2-[2-[2-[2-[(E,3E)-3-[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3,3-dimethylindol-2-ylidene]prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-[2-[(E,3E)-3-[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3,3-dimethylindol-2-ylidene]prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 130209812 |
| Molecular Formula | C38H56N3O6+ |
| Molecular Weight | 650.88 g/mol |
| Exact Mass | 650.42 |
| IUPAC Name | 2-[2-[2-[2-[(E,3E)-3-[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3,3-dimethylindol-2-ylidene]prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanamine |
| SMILES | COCCOCCOCCOCCN1/C(=C/C=C/C2=[N+](CCOCCOCCN)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C38H56N3O6/c1-37(2)31-11-6-8-13-33(31)40(18-21-44-26-25-43-20-17-39)35(37)15-10-16-36-38(3,4)32-12-7-9-14-34(32)41(36)19-22-45-27-28-47-30-29-46-24-23-42-5/h6-16H,17-30,39H2,1-5H3/q+1 |
| InChIKey | PRLGKSOCVWBPSC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.88 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|