C39H54N5O6+ — CID 171034084
2-[2-[2-[2-[(1Z,3E,5E)-5-[1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanol (PubChem CID 171034084) has the molecular formula C39H54N5O6+ and a molecular weight of 688.89 g/mol. Its IUPAC name is 2-[2-[2-[2-[(1Z,3E,5E)-5-[1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[(1Z,3E,5E)-5-[1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 171034084 |
| Molecular Formula | C39H54N5O6+ |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 688.41 |
| IUPAC Name | 2-[2-[2-[2-[(1Z,3E,5E)-5-[1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanol |
| SMILES | CC1(C)C(/C=C\C=C\C=C2\N(CCOCCOCCOCCN=[N+]=[N-])c3ccccc3C2(C)C)=[N+](CCOCCOCCO)c2ccccc21 |
| InChI | InChI=1S/C39H54N5O6/c1-38(2)32-12-8-10-14-34(32)43(19-23-47-27-29-49-25-21-45)36(38)16-6-5-7-17-37-39(3,4)33-13-9-11-15-35(33)44(37)20-24-48-28-31-50-30-26-46-22-18-41-42-40/h5-17,45H,18-31H2,1-4H3/q+1 |
| InChIKey | IUZIWSNATIPAMS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|