C42H57N2O7+ — CID 119058376
2-[2-[2-[2-[(1E,3E,5E)-5-[3,3-dimethyl-1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanol (PubChem CID 119058376) has the molecular formula C42H57N2O7+ and a molecular weight of 701.92 g/mol. Its IUPAC name is 2-[2-[2-[2-[(1E,3E,5E)-5-[3,3-dimethyl-1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[(1E,3E,5E)-5-[3,3-dimethyl-1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 119058376 |
| Molecular Formula | C42H57N2O7+ |
| Molecular Weight | 701.92 g/mol |
| Exact Mass | 701.42 |
| IUPAC Name | 2-[2-[2-[2-[(1E,3E,5E)-5-[3,3-dimethyl-1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]ethoxy]ethoxy]ethanol |
| SMILES | C#CCOCCOCCOCCOCCN1/C(=C/C=C/C=C/C2=[N+](CCOCCOCCO)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C42H57N2O7/c1-6-23-46-27-31-50-33-34-51-32-29-48-25-21-44-38-17-13-11-15-36(38)42(4,5)40(44)19-9-7-8-18-39-41(2,3)35-14-10-12-16-37(35)43(39)20-24-47-28-30-49-26-22-45/h1,7-19,45H,20-34H2,2-5H3/q+1 |
| InChIKey | MUMMXXFUFTZGAF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.92 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|