C23H22ClN3OS2 — CID 4286784
5-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-ethyl-2-(2-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 4286784) has the molecular formula C23H22ClN3OS2 and a molecular weight of 456.04 g/mol. Its IUPAC name is 5-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-ethyl-2-(2-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-ethyl-2-(2-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4286784 |
| Molecular Formula | C23H22ClN3OS2 |
| Molecular Weight | 456.04 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-ethyl-2-(2-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=CC=C2Sc3ccc(Cl)cc3N2CC)S/C1=N\c1ccccc1C |
| InChI | InChI=1S/C23H22ClN3OS2/c1-4-26-18-14-16(24)10-11-19(18)29-21(26)13-12-20-22(28)27(5-2)23(30-20)25-17-9-7-6-8-15(17)3/h6-14H,4-5H2,1-3H3/b20-12?,21-13?,25-23- |
| InChIKey | UXXLDZRNYWEXEU-GFVLOLAISA-N |
| XLogP | 6.59 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.04 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|