C26H22ClN3OS2 — CID 4686789
5-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-ethyl-2-naphthalen-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 4686789) has the molecular formula C26H22ClN3OS2 and a molecular weight of 492.07 g/mol. Its IUPAC name is 5-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-ethyl-2-naphthalen-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-ethyl-2-naphthalen-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4686789 |
| Molecular Formula | C26H22ClN3OS2 |
| Molecular Weight | 492.07 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 5-[2-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-ethyl-2-naphthalen-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=CC=C2Sc3ccc(Cl)cc3N2CC)S/C1=N\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H22ClN3OS2/c1-3-29-21-16-19(27)10-12-22(21)32-24(29)14-13-23-25(31)30(4-2)26(33-23)28-20-11-9-17-7-5-6-8-18(17)15-20/h5-16H,3-4H2,1-2H3/b23-13?,24-14?,28-26- |
| InChIKey | JIBFJVAPJAXLLB-MFFCBIJZSA-N |
| XLogP | 7.43 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.07 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|