C23H25N3OS — CID 8556773
(5E)-3-ethyl-2-(2-methylphenyl)imino-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 8556773) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is (5E)-3-ethyl-2-(2-methylphenyl)imino-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-2-(2-methylphenyl)imino-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 8556773 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (5E)-3-ethyl-2-(2-methylphenyl)imino-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(N3CCCC3)cc2)S/C1=N\c1ccccc1C |
| InChI | InChI=1S/C23H25N3OS/c1-3-26-22(27)21(28-23(26)24-20-9-5-4-8-17(20)2)16-18-10-12-19(13-11-18)25-14-6-7-15-25/h4-5,8-13,16H,3,6-7,14-15H2,1-2H3/b21-16+,24-23- |
| InChIKey | CBHDMLKUDSJGPG-RERTVAKNSA-N |
| XLogP | 5.22 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|