C21H22ClN3O2S — CID 9486336
(5E)-2-(2-chlorophenyl)imino-3-ethyl-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 9486336) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is (5E)-2-(2-chlorophenyl)imino-3-ethyl-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2-chlorophenyl)imino-3-ethyl-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 9486336 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (5E)-2-(2-chlorophenyl)imino-3-ethyl-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(N3CCCCC3)o2)S/C1=N/c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClN3O2S/c1-2-25-20(26)18(28-21(25)23-17-9-5-4-8-16(17)22)14-15-10-11-19(27-15)24-12-6-3-7-13-24/h4-5,8-11,14H,2-3,6-7,12-13H2,1H3/b18-14+,23-21+ |
| InChIKey | SHBVTWFVPXKYEP-NNCYSHEUSA-N |
| XLogP | 5.55 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|