C22H25N3O2S — CID 8990633
(5Z)-2-(3,4-dimethylphenyl)imino-3-ethyl-5-[(5-pyrrolidin-1-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 8990633) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is (5Z)-2-(3,4-dimethylphenyl)imino-3-ethyl-5-[(5-pyrrolidin-1-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3,4-dimethylphenyl)imino-3-ethyl-5-[(5-pyrrolidin-1-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 8990633 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (5Z)-2-(3,4-dimethylphenyl)imino-3-ethyl-5-[(5-pyrrolidin-1-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccc(N3CCCC3)o2)S/C1=N/c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H25N3O2S/c1-4-25-21(26)19(14-18-9-10-20(27-18)24-11-5-6-12-24)28-22(25)23-17-8-7-15(2)16(3)13-17/h7-10,13-14H,4-6,11-12H2,1-3H3/b19-14-,23-22+ |
| InChIKey | GPYCIYSXJKBDEN-UVOXWLTBSA-N |
| XLogP | 5.12 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|