C21H30N2O2S2 — CID 19131364
(5Z)-3-octyl-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 19131364) has the molecular formula C21H30N2O2S2 and a molecular weight of 406.62 g/mol. Its IUPAC name is (5Z)-3-octyl-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-octyl-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19131364 |
| Molecular Formula | C21H30N2O2S2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (5Z)-3-octyl-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCN1C(=O)/C(=C/c2ccc(N3CCCCC3)o2)SC1=S |
| InChI | InChI=1S/C21H30N2O2S2/c1-2-3-4-5-6-10-15-23-20(24)18(27-21(23)26)16-17-11-12-19(25-17)22-13-8-7-9-14-22/h11-12,16H,2-10,13-15H2,1H3/b18-16- |
| InChIKey | WHCQBUYWMHMOQH-VLGSPTGOSA-N |
| XLogP | 5.83 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|