C16H14N2O3S3 — CID 173136901
2-[5-[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-1,3-thiazolidin-3-yl]-2-sulfanylideneacetic acid (PubChem CID 173136901) has the molecular formula C16H14N2O3S3 and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-[5-[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-1,3-thiazolidin-3-yl]-2-sulfanylideneacetic acid.
| Compound Name | 2-[5-[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-1,3-thiazolidin-3-yl]-2-sulfanylideneacetic acid |
|---|---|
| PubChem CID | 173136901 |
| Molecular Formula | C16H14N2O3S3 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2-[5-[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-oxo-1,3-thiazolidin-3-yl]-2-sulfanylideneacetic acid |
| SMILES | CCN1C(=CC=C2SCN(C(=S)C(=O)O)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C16H14N2O3S3/c1-2-17-10-5-3-4-6-11(10)24-13(17)8-7-12-14(19)18(9-23-12)15(22)16(20)21/h3-8H,2,9H2,1H3,(H,20,21) |
| InChIKey | DRIPUHWLTQTXRB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|