C22H30BrClN2S — CID 155234289
3-(2-chlorophenothiazin-10-yl)propyl-dimethyl-(3-methylbutyl)azanium bromide (PubChem CID 155234289) has the molecular formula C22H30BrClN2S and a molecular weight of 469.92 g/mol. Its IUPAC name is 3-(2-chlorophenothiazin-10-yl)propyl-dimethyl-(3-methylbutyl)azanium bromide.
| Compound Name | 3-(2-chlorophenothiazin-10-yl)propyl-dimethyl-(3-methylbutyl)azanium bromide |
|---|---|
| PubChem CID | 155234289 |
| Molecular Formula | C22H30BrClN2S |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)propyl-dimethyl-(3-methylbutyl)azanium bromide |
| SMILES | CC(C)CC[N+](C)(C)CCCN1c2ccccc2Sc2ccc(Cl)cc21.[Br-] |
| InChI | InChI=1S/C22H30ClN2S.BrH/c1-17(2)12-15-25(3,4)14-7-13-24-19-8-5-6-9-21(19)26-22-11-10-18(23)16-20(22)24;/h5-6,8-11,16-17H,7,12-15H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | YPGSWSWJRCEZQM-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|