C23H33N2S+ — CID 155714523
dimethyl-[3-(2-methylphenothiazin-10-yl)propyl]-pentylazanium (PubChem CID 155714523) has the molecular formula C23H33N2S+ and a molecular weight of 369.60 g/mol. Its IUPAC name is dimethyl-[3-(2-methylphenothiazin-10-yl)propyl]-pentylazanium.
| Compound Name | dimethyl-[3-(2-methylphenothiazin-10-yl)propyl]-pentylazanium |
|---|---|
| PubChem CID | 155714523 |
| Molecular Formula | C23H33N2S+ |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | dimethyl-[3-(2-methylphenothiazin-10-yl)propyl]-pentylazanium |
| SMILES | CCCCC[N+](C)(C)CCCN1c2ccccc2Sc2ccc(C)cc21 |
| InChI | InChI=1S/C23H33N2S/c1-5-6-9-16-25(3,4)17-10-15-24-20-11-7-8-12-22(20)26-23-14-13-19(2)18-21(23)24/h7-8,11-14,18H,5-6,9-10,15-17H2,1-4H3/q+1 |
| InChIKey | UPRUWDUZYLKPCS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|