C24H26ClN2S+ — CID 16729202
(4-chlorophenyl)methyl-dimethyl-(3-phenothiazin-10-ylpropyl)azanium (PubChem CID 16729202) has the molecular formula C24H26ClN2S+ and a molecular weight of 410.01 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-dimethyl-(3-phenothiazin-10-ylpropyl)azanium.
| Compound Name | (4-chlorophenyl)methyl-dimethyl-(3-phenothiazin-10-ylpropyl)azanium |
|---|---|
| PubChem CID | 16729202 |
| Molecular Formula | C24H26ClN2S+ |
| Molecular Weight | 410.01 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (4-chlorophenyl)methyl-dimethyl-(3-phenothiazin-10-ylpropyl)azanium |
| SMILES | C[N+](C)(CCCN1c2ccccc2Sc2ccccc21)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26ClN2S/c1-27(2,18-19-12-14-20(25)15-13-19)17-7-16-26-21-8-3-5-10-23(21)28-24-11-6-4-9-22(24)26/h3-6,8-15H,7,16-18H2,1-2H3/q+1 |
| InChIKey | HKELWZNXKOTJMW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.01 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|