C25H25Br2F3N2S — CID 70693050
(4-bromophenyl)methyl-dimethyl-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]azanium bromide (PubChem CID 70693050) has the molecular formula C25H25Br2F3N2S and a molecular weight of 602.36 g/mol. Its IUPAC name is (4-bromophenyl)methyl-dimethyl-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]azanium bromide.
| Compound Name | (4-bromophenyl)methyl-dimethyl-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]azanium bromide |
|---|---|
| PubChem CID | 70693050 |
| Molecular Formula | C25H25Br2F3N2S |
| Molecular Weight | 602.36 g/mol |
| Exact Mass | 600.01 |
| IUPAC Name | (4-bromophenyl)methyl-dimethyl-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]azanium bromide |
| SMILES | C[N+](C)(CCCN1c2ccccc2Sc2ccc(C(F)(F)F)cc21)Cc1ccc(Br)cc1.[Br-] |
| InChI | InChI=1S/C25H25BrF3N2S.BrH/c1-31(2,17-18-8-11-20(26)12-9-18)15-5-14-30-21-6-3-4-7-23(21)32-24-13-10-19(16-22(24)30)25(27,28)29;/h3-4,6-13,16H,5,14-15,17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZXIWSAYSCIBINV-UHFFFAOYSA-M |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|