C26H30Cl2N2O2S — CID 10696897
3-(2-chlorophenothiazin-10-yl)propyl-[(3,4-dimethoxyphenyl)methyl]-dimethylazanium chloride (PubChem CID 10696897) has the molecular formula C26H30Cl2N2O2S and a molecular weight of 505.51 g/mol. Its IUPAC name is 3-(2-chlorophenothiazin-10-yl)propyl-[(3,4-dimethoxyphenyl)methyl]-dimethylazanium chloride.
| Compound Name | 3-(2-chlorophenothiazin-10-yl)propyl-[(3,4-dimethoxyphenyl)methyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 10696897 |
| Molecular Formula | C26H30Cl2N2O2S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)propyl-[(3,4-dimethoxyphenyl)methyl]-dimethylazanium chloride |
| SMILES | COc1ccc(C[N+](C)(C)CCCN2c3ccccc3Sc3ccc(Cl)cc32)cc1OC.[Cl-] |
| InChI | InChI=1S/C26H30ClN2O2S.ClH/c1-29(2,18-19-10-12-23(30-3)24(16-19)31-4)15-7-14-28-21-8-5-6-9-25(21)32-26-13-11-20(27)17-22(26)28;/h5-6,8-13,16-17H,7,14-15,18H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RUENTMBNZNYACT-UHFFFAOYSA-M |
| XLogP | 3.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|