C26H26ClNO3S — CID 173258112
6-(2-chlorophenothiazin-10-yl)-1-(3,4-dimethoxyphenyl)hexan-2-one (PubChem CID 173258112) has the molecular formula C26H26ClNO3S and a molecular weight of 468.02 g/mol. Its IUPAC name is 6-(2-chlorophenothiazin-10-yl)-1-(3,4-dimethoxyphenyl)hexan-2-one.
| Compound Name | 6-(2-chlorophenothiazin-10-yl)-1-(3,4-dimethoxyphenyl)hexan-2-one |
|---|---|
| PubChem CID | 173258112 |
| Molecular Formula | C26H26ClNO3S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 6-(2-chlorophenothiazin-10-yl)-1-(3,4-dimethoxyphenyl)hexan-2-one |
| SMILES | COc1ccc(CC(=O)CCCCN2c3ccccc3Sc3ccc(Cl)cc32)cc1OC |
| InChI | InChI=1S/C26H26ClNO3S/c1-30-23-12-10-18(16-24(23)31-2)15-20(29)7-5-6-14-28-21-8-3-4-9-25(21)32-26-13-11-19(27)17-22(26)28/h3-4,8-13,16-17H,5-7,14-15H2,1-2H3 |
| InChIKey | RVAGOKLZKSAYSW-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|