C23H28ClN3O3S — CID 130177451
2-methoxyethyl 4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazine-1-carboxylate (PubChem CID 130177451) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is 2-methoxyethyl 4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazine-1-carboxylate.
| Compound Name | 2-methoxyethyl 4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 130177451 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-methoxyethyl 4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazine-1-carboxylate |
| SMILES | COCCOC(=O)N1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C23H28ClN3O3S/c1-29-15-16-30-23(28)26-13-11-25(12-14-26)9-4-10-27-19-5-2-3-6-21(19)31-22-8-7-18(24)17-20(22)27/h2-3,5-8,17H,4,9-16H2,1H3 |
| InChIKey | MZSKNVYLYIPTHY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|