C26H35ClN3O3S- — CID 131740566
2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol;pentanoate (PubChem CID 131740566) has the molecular formula C26H35ClN3O3S- and a molecular weight of 505.10 g/mol. Its IUPAC name is 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol;pentanoate.
| Compound Name | 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol;pentanoate |
|---|---|
| PubChem CID | 131740566 |
| Molecular Formula | C26H35ClN3O3S- |
| Molecular Weight | 505.10 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol;pentanoate |
| SMILES | CCCCC(=O)[O-].OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C21H26ClN3OS.C5H10O2/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26;1-2-3-4-5(6)7/h1-2,4-7,16,26H,3,8-15H2;2-4H2,1H3,(H,6,7)/p-1 |
| InChIKey | SYUALJMNXPJTRV-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.10 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |