C25H36N4O2S2 — CID 90928542
10-[3-(4-butylpiperazin-1-yl)propyl]-N,N-dimethylphenothiazine-2-sulfonamide (PubChem CID 90928542) has the molecular formula C25H36N4O2S2 and a molecular weight of 488.72 g/mol. Its IUPAC name is 10-[3-(4-butylpiperazin-1-yl)propyl]-N,N-dimethylphenothiazine-2-sulfonamide.
| Compound Name | 10-[3-(4-butylpiperazin-1-yl)propyl]-N,N-dimethylphenothiazine-2-sulfonamide |
|---|---|
| PubChem CID | 90928542 |
| Molecular Formula | C25H36N4O2S2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 10-[3-(4-butylpiperazin-1-yl)propyl]-N,N-dimethylphenothiazine-2-sulfonamide |
| SMILES | CCCCN1CCN(CCCN2c3ccccc3Sc3ccc(S(=O)(=O)N(C)C)cc32)CC1 |
| InChI | InChI=1S/C25H36N4O2S2/c1-4-5-13-27-16-18-28(19-17-27)14-8-15-29-22-9-6-7-10-24(22)32-25-12-11-21(20-23(25)29)33(30,31)26(2)3/h6-7,9-12,20H,4-5,8,13-19H2,1-3H3 |
| InChIKey | FAJDULHVCJLBIU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |