C31H32ClN2S+ — CID 10345866
(4-benzylphenyl)methyl-[3-(2-chlorophenothiazin-10-yl)propyl]-dimethylazanium (PubChem CID 10345866) has the molecular formula C31H32ClN2S+ and a molecular weight of 500.13 g/mol. Its IUPAC name is (4-benzylphenyl)methyl-[3-(2-chlorophenothiazin-10-yl)propyl]-dimethylazanium.
| Compound Name | (4-benzylphenyl)methyl-[3-(2-chlorophenothiazin-10-yl)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 10345866 |
| Molecular Formula | C31H32ClN2S+ |
| Molecular Weight | 500.13 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (4-benzylphenyl)methyl-[3-(2-chlorophenothiazin-10-yl)propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCN1c2ccccc2Sc2ccc(Cl)cc21)Cc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H32ClN2S/c1-34(2,23-26-15-13-25(14-16-26)21-24-9-4-3-5-10-24)20-8-19-33-28-11-6-7-12-30(28)35-31-18-17-27(32)22-29(31)33/h3-7,9-18,22H,8,19-21,23H2,1-2H3/q+1 |
| InChIKey | UUNQUEJQVZAPQZ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.13 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|