C20H24ClNS — CID 155242935
2-chloro-10-(4-methylheptyl)phenothiazine (PubChem CID 155242935) has the molecular formula C20H24ClNS and a molecular weight of 345.94 g/mol. Its IUPAC name is 2-chloro-10-(4-methylheptyl)phenothiazine.
| Compound Name | 2-chloro-10-(4-methylheptyl)phenothiazine |
|---|---|
| PubChem CID | 155242935 |
| Molecular Formula | C20H24ClNS |
| Molecular Weight | 345.94 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-chloro-10-(4-methylheptyl)phenothiazine |
| SMILES | CCCC(C)CCCN1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H24ClNS/c1-3-7-15(2)8-6-13-22-17-9-4-5-10-19(17)23-20-12-11-16(21)14-18(20)22/h4-5,9-12,14-15H,3,6-8,13H2,1-2H3 |
| InChIKey | LZQPUCWEMHXJIT-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.94 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |