C21H27ClN2S — CID 19029744
1-(2-chlorophenothiazin-10-yl)-N,N-dimethylheptan-4-amine (PubChem CID 19029744) has the molecular formula C21H27ClN2S and a molecular weight of 374.98 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)-N,N-dimethylheptan-4-amine.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)-N,N-dimethylheptan-4-amine |
|---|---|
| PubChem CID | 19029744 |
| Molecular Formula | C21H27ClN2S |
| Molecular Weight | 374.98 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)-N,N-dimethylheptan-4-amine |
| SMILES | CCCC(CCCN1c2ccccc2Sc2ccc(Cl)cc21)N(C)C |
| InChI | InChI=1S/C21H27ClN2S/c1-4-8-17(23(2)3)9-7-14-24-18-10-5-6-11-20(18)25-21-13-12-16(22)15-19(21)24/h5-6,10-13,15,17H,4,7-9,14H2,1-3H3 |
| InChIKey | BTGGAJQXVSDWLS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.98 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |