C20H25ClN3S+ — CID 25203624
2-chloro-10-[3-(4-methylpiperazin-1-ium-1-yl)propyl]phenothiazine (PubChem CID 25203624) has the molecular formula C20H25ClN3S+ and a molecular weight of 374.96 g/mol. Its IUPAC name is 2-chloro-10-[3-(4-methylpiperazin-1-ium-1-yl)propyl]phenothiazine.
| Compound Name | 2-chloro-10-[3-(4-methylpiperazin-1-ium-1-yl)propyl]phenothiazine |
|---|---|
| PubChem CID | 25203624 |
| Molecular Formula | C20H25ClN3S+ |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-chloro-10-[3-(4-methylpiperazin-1-ium-1-yl)propyl]phenothiazine |
| SMILES | CN1CC[NH+](CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C20H24ClN3S/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)25-20-8-7-16(21)15-18(20)24/h2-3,5-8,15H,4,9-14H2,1H3/p+1 |
| InChIKey | WIKYUJGCLQQFNW-UHFFFAOYSA-O |
| XLogP | 3.16 |
| TPSA | 10.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |