C18H21ClN4OS — CID 89080505
1-(2-chlorophenothiazin-10-yl)-N-(4-methylpiperazin-1-yl)oxymethanamine (PubChem CID 89080505) has the molecular formula C18H21ClN4OS and a molecular weight of 376.91 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)-N-(4-methylpiperazin-1-yl)oxymethanamine.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)-N-(4-methylpiperazin-1-yl)oxymethanamine |
|---|---|
| PubChem CID | 89080505 |
| Molecular Formula | C18H21ClN4OS |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)-N-(4-methylpiperazin-1-yl)oxymethanamine |
| SMILES | CN1CCN(ONCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C18H21ClN4OS/c1-21-8-10-22(11-9-21)24-20-13-23-15-4-2-3-5-17(15)25-18-7-6-14(19)12-16(18)23/h2-7,12,20H,8-11,13H2,1H3 |
| InChIKey | DYOWZZGFAJXCBQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|